C9H11Cl2N — CID 123835711
2,8-dichloro-3,7-dimethyl-4,5-dihydroazocine (PubChem CID 123835711) has the molecular formula C9H11Cl2N and a molecular weight of 204.10 g/mol. Its IUPAC name is 2,8-dichloro-3,7-dimethyl-4,5-dihydroazocine.
| Compound Name | 2,8-dichloro-3,7-dimethyl-4,5-dihydroazocine |
|---|---|
| PubChem CID | 123835711 |
| Molecular Formula | C9H11Cl2N |
| Molecular Weight | 204.10 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 2,8-dichloro-3,7-dimethyl-4,5-dihydroazocine |
| SMILES | CC1=CCCC(C)=C(Cl)N=C1Cl |
| InChI | InChI=1S/C9H11Cl2N/c1-6-4-3-5-7(2)9(11)12-8(6)10/h4H,3,5H2,1-2H3 |
| InChIKey | WCSYAWWFTNOKBM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.10 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|