C8H8Cl3N — CID 123888465
2,5,7-trichloro-3-ethyl-4H-azepine (PubChem CID 123888465) has the molecular formula C8H8Cl3N and a molecular weight of 224.52 g/mol. Its IUPAC name is 2,5,7-trichloro-3-ethyl-4H-azepine.
| Compound Name | 2,5,7-trichloro-3-ethyl-4H-azepine |
|---|---|
| PubChem CID | 123888465 |
| Molecular Formula | C8H8Cl3N |
| Molecular Weight | 224.52 g/mol |
| Exact Mass | 222.97 |
| IUPAC Name | 2,5,7-trichloro-3-ethyl-4H-azepine |
| SMILES | CCC1=C(Cl)N=C(Cl)C=C(Cl)C1 |
| InChI | InChI=1S/C8H8Cl3N/c1-2-5-3-6(9)4-7(10)12-8(5)11/h4H,2-3H2,1H3 |
| InChIKey | DXCBNMARIYAETH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|