C8H14ClN — CID 90815478
N,3-dimethylhex-2-enimidoyl chloride (PubChem CID 90815478) has the molecular formula C8H14ClN and a molecular weight of 159.66 g/mol. Its IUPAC name is N,3-dimethylhex-2-enimidoyl chloride.
| Compound Name | N,3-dimethylhex-2-enimidoyl chloride |
|---|---|
| PubChem CID | 90815478 |
| Molecular Formula | C8H14ClN |
| Molecular Weight | 159.66 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | N,3-dimethylhex-2-enimidoyl chloride |
| SMILES | CCCC(C)=C/C(Cl)=N/C |
| InChI | InChI=1S/C8H14ClN/c1-4-5-7(2)6-8(9)10-3/h6H,4-5H2,1-3H3/b7-6?,10-8- |
| InChIKey | XOEDZPILAPKBJV-CJHDCQNGSA-N |
| XLogP | 3.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.66 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|