C9H13Cl2N — CID 143382576
(E,1E)-N-[(E)-1-chloroprop-1-enyl]-3-methylpent-2-enimidoyl chloride (PubChem CID 143382576) has the molecular formula C9H13Cl2N and a molecular weight of 206.12 g/mol. Its IUPAC name is (E,1E)-N-[(E)-1-chloroprop-1-enyl]-3-methylpent-2-enimidoyl chloride.
| Compound Name | (E,1E)-N-[(E)-1-chloroprop-1-enyl]-3-methylpent-2-enimidoyl chloride |
|---|---|
| PubChem CID | 143382576 |
| Molecular Formula | C9H13Cl2N |
| Molecular Weight | 206.12 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | (E,1E)-N-[(E)-1-chloroprop-1-enyl]-3-methylpent-2-enimidoyl chloride |
| SMILES | C/C=C(Cl)\N=C(Cl)/C=C(\C)CC |
| InChI | InChI=1S/C9H13Cl2N/c1-4-7(3)6-9(11)12-8(10)5-2/h5-6H,4H2,1-3H3/b7-6+,8-5-,12-9+ |
| InChIKey | WOEPDKKHHCTHQD-NXVLDRLOSA-N |
| XLogP | 4.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.12 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|