C9H12ClN — CID 123890337
2-chloro-7,8-dimethyl-4,5-dihydroazocine (PubChem CID 123890337) has the molecular formula C9H12ClN and a molecular weight of 169.65 g/mol. Its IUPAC name is 2-chloro-7,8-dimethyl-4,5-dihydroazocine.
| Compound Name | 2-chloro-7,8-dimethyl-4,5-dihydroazocine |
|---|---|
| PubChem CID | 123890337 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.65 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-chloro-7,8-dimethyl-4,5-dihydroazocine |
| SMILES | CC1=CCCC=C(Cl)N=C1C |
| InChI | InChI=1S/C9H12ClN/c1-7-5-3-4-6-9(10)11-8(7)2/h5-6H,3-4H2,1-2H3 |
| InChIKey | BEMXIJITJQAKKA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|