About 6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine
6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 123836232) has the molecular formula C15H10F2N4O
and a molecular weight of 300.27 g/mol. Its IUPAC name is 6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 123836232 |
| Molecular Formula | C15H10F2N4O |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2[nH]c(C#CCOc3cc(F)ccc3F)cc12 |
| InChI | InChI=1S/C15H10F2N4O/c16-9-3-4-12(17)13(6-9)22-5-1-2-10-7-11-14(18)19-8-20-15(11)21-10/h3-4,6-8H,5H2,(H3,18,19,20,21) |
| InChIKey | LYCAKQWUDNLJTI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of 6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CID 123836232) is 6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine is Nc1ncnc2[nH]c(C#CCOc3cc(F)ccc3F)cc12.
What is the InChIKey of 6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is LYCAKQWUDNLJTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F2N4O/c16-9-3-4-12(17)13(6-9)22-5-1-2-10-7-11-14(18)19-8-20-15(11)21-10/h3-4,6-8H,5H2,(H3,18,19,20,21).
What are the key properties of 6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 300.27 g/mol, XLogP of 2.25, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(2,5-difluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 123836232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).