C22H27N5O3 — CID 123836325
propan-2-yl 4-[4-[(4-cyanophenoxy)methyl]-5-(methyliminomethyl)pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 123836325) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is propan-2-yl 4-[4-[(4-cyanophenoxy)methyl]-5-(methyliminomethyl)pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[4-[(4-cyanophenoxy)methyl]-5-(methyliminomethyl)pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123836325 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | propan-2-yl 4-[4-[(4-cyanophenoxy)methyl]-5-(methyliminomethyl)pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | C/N=C/c1c(COc2ccc(C#N)cc2)cnn1C1CCN(C(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C22H27N5O3/c1-16(2)30-22(28)26-10-8-19(9-11-26)27-21(14-24-3)18(13-25-27)15-29-20-6-4-17(12-23)5-7-20/h4-7,13-14,16,19H,8-11,15H2,1-3H3/b24-14+ |
| InChIKey | FCPYGBWXARIRIF-ZVHZXABRSA-N |
| XLogP | 3.56 |
| TPSA | 92.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|