C28H41FN4O4SSi — CID 58114329
propan-2-yl 4-[4-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]-2-fluorophenoxy]methyl]-5-cyanopyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 58114329) has the molecular formula C28H41FN4O4SSi and a molecular weight of 576.81 g/mol. Its IUPAC name is propan-2-yl 4-[4-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]-2-fluorophenoxy]methyl]-5-cyanopyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[4-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]-2-fluorophenoxy]methyl]-5-cyanopyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58114329 |
| Molecular Formula | C28H41FN4O4SSi |
| Molecular Weight | 576.81 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | propan-2-yl 4-[4-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfanyl]-2-fluorophenoxy]methyl]-5-cyanopyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCC(n2ncc(COc3ccc(SCCO[Si](C)(C)C(C)(C)C)cc3F)c2C#N)CC1 |
| InChI | InChI=1S/C28H41FN4O4SSi/c1-20(2)37-27(34)32-12-10-22(11-13-32)33-25(17-30)21(18-31-33)19-35-26-9-8-23(16-24(26)29)38-15-14-36-39(6,7)28(3,4)5/h8-9,16,18,20,22H,10-15,19H2,1-7H3 |
| InChIKey | JSYMMCLXRPGHBV-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 89.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.81 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|