C13H15N5O — CID 123836513
N,N-dimethyl-3,4,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,10,12-pentaene-5-carboxamide (PubChem CID 123836513) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is N,N-dimethyl-3,4,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,10,12-pentaene-5-carboxamide.
| Compound Name | N,N-dimethyl-3,4,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 123836513 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N,N-dimethyl-3,4,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),2,5,10,12-pentaene-5-carboxamide |
| SMILES | CN(C)C(=O)c1[nH]nc2c1CCCc1cncnc1-2 |
| InChI | InChI=1S/C13H15N5O/c1-18(2)13(19)12-9-5-3-4-8-6-14-7-15-10(8)11(9)16-17-12/h6-7H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | ATPIIZNKBRNJEO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |