C14H17N5OW — CID 20756903
ethane;N-ethyl-6,7-dihydro-5H-pyrazolo[3,4-h]quinazoline-9-carboxamide;tungsten(2+) (PubChem CID 20756903) has the molecular formula C14H17N5OW and a molecular weight of 455.16 g/mol. Its IUPAC name is ethane;N-ethyl-6,7-dihydro-5H-pyrazolo[3,4-h]quinazoline-9-carboxamide;tungsten(2+).
| Compound Name | ethane;N-ethyl-6,7-dihydro-5H-pyrazolo[3,4-h]quinazoline-9-carboxamide;tungsten(2+) |
|---|---|
| PubChem CID | 20756903 |
| Molecular Formula | C14H17N5OW |
| Molecular Weight | 455.16 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | ethane;N-ethyl-6,7-dihydro-5H-pyrazolo[3,4-h]quinazoline-9-carboxamide;tungsten(2+) |
| SMILES | [CH2-]C.[CH2-]CNC(=O)c1n[nH]c2c1-c1ncncc1CC2.[W+2] |
| InChI | InChI=1S/C12H12N5O.C2H5.W/c1-2-14-12(18)11-9-8(16-17-11)4-3-7-5-13-6-15-10(7)9;1-2;/h5-6H,1-4H2,(H,14,18)(H,16,17);1H2,2H3;/q2*-1;+2 |
| InChIKey | PGUQFIWWGNBWPU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|