C20H27N5O3 — CID 158879158
4-methoxyimino-N-[4-[2-(propylamino)ethoxy]phenyl]-1,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 158879158) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-methoxyimino-N-[4-[2-(propylamino)ethoxy]phenyl]-1,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 4-methoxyimino-N-[4-[2-(propylamino)ethoxy]phenyl]-1,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 158879158 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 4-methoxyimino-N-[4-[2-(propylamino)ethoxy]phenyl]-1,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CCCNCCOc1ccc(NC(=O)c2n[nH]c3c2C(=NOC)CCC3)cc1 |
| InChI | InChI=1S/C20H27N5O3/c1-3-11-21-12-13-28-15-9-7-14(8-10-15)22-20(26)19-18-16(23-24-19)5-4-6-17(18)25-27-2/h7-10,21H,3-6,11-13H2,1-2H3,(H,22,26)(H,23,24) |
| InChIKey | JCUXPUFBPMVXIO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|