C21H28BN3O4 — CID 59917848
methyl-N-[2-[4-[(4-oxo-1,5,6,7-tetrahydroindole-3-carbonyl)amino]phenoxy]ethyl]-N-propylboronamidic acid (PubChem CID 59917848) has the molecular formula C21H28BN3O4 and a molecular weight of 397.28 g/mol. Its IUPAC name is methyl-N-[2-[4-[(4-oxo-1,5,6,7-tetrahydroindole-3-carbonyl)amino]phenoxy]ethyl]-N-propylboronamidic acid.
| Compound Name | methyl-N-[2-[4-[(4-oxo-1,5,6,7-tetrahydroindole-3-carbonyl)amino]phenoxy]ethyl]-N-propylboronamidic acid |
|---|---|
| PubChem CID | 59917848 |
| Molecular Formula | C21H28BN3O4 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | methyl-N-[2-[4-[(4-oxo-1,5,6,7-tetrahydroindole-3-carbonyl)amino]phenoxy]ethyl]-N-propylboronamidic acid |
| SMILES | CCCN(CCOc1ccc(NC(=O)c2c[nH]c3c2C(=O)CCC3)cc1)B(C)O |
| InChI | InChI=1S/C21H28BN3O4/c1-3-11-25(22(2)28)12-13-29-16-9-7-15(8-10-16)24-21(27)17-14-23-18-5-4-6-19(26)20(17)18/h7-10,14,23,28H,3-6,11-13H2,1-2H3,(H,24,27) |
| InChIKey | IYGWIJPOFIFQLI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|