C14H13N3O2 — CID 18696546
4-oxo-N-pyridin-4-yl-1,5,6,7-tetrahydroindole-3-carboxamide (PubChem CID 18696546) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 4-oxo-N-pyridin-4-yl-1,5,6,7-tetrahydroindole-3-carboxamide.
| Compound Name | 4-oxo-N-pyridin-4-yl-1,5,6,7-tetrahydroindole-3-carboxamide |
|---|---|
| PubChem CID | 18696546 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-oxo-N-pyridin-4-yl-1,5,6,7-tetrahydroindole-3-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1c[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C14H13N3O2/c18-12-3-1-2-11-13(12)10(8-16-11)14(19)17-9-4-6-15-7-5-9/h4-8,16H,1-3H2,(H,15,17,19) |
| InChIKey | LCWVLEUWDWLYKG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |