C16H16N2O3 — CID 22730890
N-(4-hydroxyphenyl)-6-methyl-4-oxo-1,5,6,7-tetrahydroindole-3-carboxamide (PubChem CID 22730890) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-6-methyl-4-oxo-1,5,6,7-tetrahydroindole-3-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-6-methyl-4-oxo-1,5,6,7-tetrahydroindole-3-carboxamide |
|---|---|
| PubChem CID | 22730890 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-(4-hydroxyphenyl)-6-methyl-4-oxo-1,5,6,7-tetrahydroindole-3-carboxamide |
| SMILES | CC1CC(=O)c2c(C(=O)Nc3ccc(O)cc3)c[nH]c2C1 |
| InChI | InChI=1S/C16H16N2O3/c1-9-6-13-15(14(20)7-9)12(8-17-13)16(21)18-10-2-4-11(19)5-3-10/h2-5,8-9,17,19H,6-7H2,1H3,(H,18,21) |
| InChIKey | GAMPSXPVBALFCE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|