C16H14N2O4 — CID 15337628
4-[(4-oxo-1,5,6,7-tetrahydroindole-3-carbonyl)amino]benzoic acid (PubChem CID 15337628) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 4-[(4-oxo-1,5,6,7-tetrahydroindole-3-carbonyl)amino]benzoic acid.
| Compound Name | 4-[(4-oxo-1,5,6,7-tetrahydroindole-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 15337628 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 4-[(4-oxo-1,5,6,7-tetrahydroindole-3-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2c[nH]c3c2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C16H14N2O4/c19-13-3-1-2-12-14(13)11(8-17-12)15(20)18-10-6-4-9(5-7-10)16(21)22/h4-8,17H,1-3H2,(H,18,20)(H,21,22) |
| InChIKey | LALPEYCYKSWWQY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |