C19H20N4O2 — CID 90745020
(7S)-N-(4-ethoxyphenyl)-7-methyl-3,6,10-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraene-12-carboxamide (PubChem CID 90745020) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is (7S)-N-(4-ethoxyphenyl)-7-methyl-3,6,10-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraene-12-carboxamide.
| Compound Name | (7S)-N-(4-ethoxyphenyl)-7-methyl-3,6,10-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 90745020 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (7S)-N-(4-ethoxyphenyl)-7-methyl-3,6,10-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraene-12-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2c[nH]c3c2-c2nccn2[C@@H](C)C3)cc1 |
| InChI | InChI=1S/C19H20N4O2/c1-3-25-14-6-4-13(5-7-14)22-19(24)15-11-21-16-10-12(2)23-9-8-20-18(23)17(15)16/h4-9,11-12,21H,3,10H2,1-2H3,(H,22,24)/t12-/m0/s1 |
| InChIKey | WXSYKIGFHWFWSU-LBPRGKRZSA-N |
| XLogP | 3.65 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |