C23H27N3O2S — CID 91400095
4-methyl-N-(4-pentoxyphenyl)-5-thia-3,11-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraene-13-carboxamide (PubChem CID 91400095) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 4-methyl-N-(4-pentoxyphenyl)-5-thia-3,11-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraene-13-carboxamide.
| Compound Name | 4-methyl-N-(4-pentoxyphenyl)-5-thia-3,11-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraene-13-carboxamide |
|---|---|
| PubChem CID | 91400095 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 4-methyl-N-(4-pentoxyphenyl)-5-thia-3,11-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraene-13-carboxamide |
| SMILES | CCCCCOc1ccc(NC(=O)c2c[nH]c3c2-c2nc(C)sc2CCC3)cc1 |
| InChI | InChI=1S/C23H27N3O2S/c1-3-4-5-13-28-17-11-9-16(10-12-17)26-23(27)18-14-24-19-7-6-8-20-22(21(18)19)25-15(2)29-20/h9-12,14,24H,3-8,13H2,1-2H3,(H,26,27) |
| InChIKey | ZVGQYIDWNFQNOP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|