C21H26FN5O4 — CID 140523209
N-[3-fluoro-4-(2-morpholin-4-ylethoxy)phenyl]-4-methoxyimino-1,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 140523209) has the molecular formula C21H26FN5O4 and a molecular weight of 431.47 g/mol. Its IUPAC name is N-[3-fluoro-4-(2-morpholin-4-ylethoxy)phenyl]-4-methoxyimino-1,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | N-[3-fluoro-4-(2-morpholin-4-ylethoxy)phenyl]-4-methoxyimino-1,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 140523209 |
| Molecular Formula | C21H26FN5O4 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-[3-fluoro-4-(2-morpholin-4-ylethoxy)phenyl]-4-methoxyimino-1,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CON=C1CCCc2[nH]nc(C(=O)Nc3ccc(OCCN4CCOCC4)c(F)c3)c21 |
| InChI | InChI=1S/C21H26FN5O4/c1-29-26-17-4-2-3-16-19(17)20(25-24-16)21(28)23-14-5-6-18(15(22)13-14)31-12-9-27-7-10-30-11-8-27/h5-6,13H,2-4,7-12H2,1H3,(H,23,28)(H,24,25) |
| InChIKey | FNTWRNQFNSEIDY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|