C24H19FN6O4 — CID 123837604
N-[2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]-3,5-dioxocyclohexane-1-carboxamide (PubChem CID 123837604) has the molecular formula C24H19FN6O4 and a molecular weight of 474.45 g/mol. Its IUPAC name is N-[2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]-3,5-dioxocyclohexane-1-carboxamide.
| Compound Name | N-[2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]-3,5-dioxocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 123837604 |
| Molecular Formula | C24H19FN6O4 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-[2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]-3,5-dioxocyclohexane-1-carboxamide |
| SMILES | O=C1CC(=O)CC(C(=O)Nc2ccnc(-c3cc(-c4ccon4)n(Cc4ccccc4F)n3)n2)C1 |
| InChI | InChI=1S/C24H19FN6O4/c25-18-4-2-1-3-14(18)13-31-21(19-6-8-35-30-19)12-20(29-31)23-26-7-5-22(27-23)28-24(34)15-9-16(32)11-17(33)10-15/h1-8,12,15H,9-11,13H2,(H,26,27,28,34) |
| InChIKey | KTRFBCQCTHNLLU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 132.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|