C38H55N — CID 123839451
N-[1-[2-[3-(6-cyclopropyl-2-methylocta-1,3-dien-3-yl)-5-ethenylidene-6-ethylundeca-8,9-dienyl]cyclooct-2-en-7-yn-1-yl]ethyl]methanimine (PubChem CID 123839451) has the molecular formula C38H55N and a molecular weight of 525.87 g/mol. Its IUPAC name is N-[1-[2-[3-(6-cyclopropyl-2-methylocta-1,3-dien-3-yl)-5-ethenylidene-6-ethylundeca-8,9-dienyl]cyclooct-2-en-7-yn-1-yl]ethyl]methanimine.
| Compound Name | N-[1-[2-[3-(6-cyclopropyl-2-methylocta-1,3-dien-3-yl)-5-ethenylidene-6-ethylundeca-8,9-dienyl]cyclooct-2-en-7-yn-1-yl]ethyl]methanimine |
|---|---|
| PubChem CID | 123839451 |
| Molecular Formula | C38H55N |
| Molecular Weight | 525.87 g/mol |
| Exact Mass | 525.43 |
| IUPAC Name | N-[1-[2-[3-(6-cyclopropyl-2-methylocta-1,3-dien-3-yl)-5-ethenylidene-6-ethylundeca-8,9-dienyl]cyclooct-2-en-7-yn-1-yl]ethyl]methanimine |
| SMILES | C=C=C(CC(CCC1=CCCCC#CC1C(C)N=C)C(=CCC(CC)C1CC1)C(=C)C)C(CC)CC=C=CC |
| InChI | InChI=1S/C38H55N/c1-9-13-16-19-31(10-2)33(12-4)28-36(37(29(5)6)27-26-32(11-3)34-22-23-34)25-24-35-20-17-14-15-18-21-38(35)30(7)39-8/h9,16,20,27,30-32,34,36,38H,4-5,8,10-11,14-15,17,19,22-26,28H2,1-3,6-7H3 |
| InChIKey | JMAAQAYVGNOVSB-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.87 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|