C20H35N — CID 163808808
N-[6-[2-[(1E)-1-(2-ethylcyclopropylidene)propan-2-yl]cyclopropyl]-3,4-dimethylhexan-2-yl]methanimine (PubChem CID 163808808) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is N-[6-[2-[(1E)-1-(2-ethylcyclopropylidene)propan-2-yl]cyclopropyl]-3,4-dimethylhexan-2-yl]methanimine.
| Compound Name | N-[6-[2-[(1E)-1-(2-ethylcyclopropylidene)propan-2-yl]cyclopropyl]-3,4-dimethylhexan-2-yl]methanimine |
|---|---|
| PubChem CID | 163808808 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | N-[6-[2-[(1E)-1-(2-ethylcyclopropylidene)propan-2-yl]cyclopropyl]-3,4-dimethylhexan-2-yl]methanimine |
| SMILES | C=NC(C)C(C)C(C)CCC1CC1C(C)/C=C1\CC1CC |
| InChI | InChI=1S/C20H35N/c1-7-17-11-19(17)10-14(3)20-12-18(20)9-8-13(2)15(4)16(5)21-6/h10,13-18,20H,6-9,11-12H2,1-5H3/b19-10+ |
| InChIKey | NLLBHJJDIOLPHO-VXLYETTFSA-N |
| XLogP | 5.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|