C11H17N — CID 91145112
N-[1-(3-ethylcyclopropen-1-yl)pent-4-en-2-yl]methanimine (PubChem CID 91145112) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is N-[1-(3-ethylcyclopropen-1-yl)pent-4-en-2-yl]methanimine.
| Compound Name | N-[1-(3-ethylcyclopropen-1-yl)pent-4-en-2-yl]methanimine |
|---|---|
| PubChem CID | 91145112 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N-[1-(3-ethylcyclopropen-1-yl)pent-4-en-2-yl]methanimine |
| SMILES | C=CCC(CC1=CC1CC)N=C |
| InChI | InChI=1S/C11H17N/c1-4-6-11(12-3)8-10-7-9(10)5-2/h4,7,9,11H,1,3,5-6,8H2,2H3 |
| InChIKey | JWNPHPXPSBXEJQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|