C15H25N — CID 123139562
3-butylidene-2-(2-methylbutyl)-2,4-dihydroazepine (PubChem CID 123139562) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 3-butylidene-2-(2-methylbutyl)-2,4-dihydroazepine.
| Compound Name | 3-butylidene-2-(2-methylbutyl)-2,4-dihydroazepine |
|---|---|
| PubChem CID | 123139562 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 3-butylidene-2-(2-methylbutyl)-2,4-dihydroazepine |
| SMILES | CCCC=C1CC=CC=NC1CC(C)CC |
| InChI | InChI=1S/C15H25N/c1-4-6-9-14-10-7-8-11-16-15(14)12-13(3)5-2/h7-9,11,13,15H,4-6,10,12H2,1-3H3 |
| InChIKey | GMFSIOCLRNSMAP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|