C17H31N — CID 57120345
2-(2,8-dimethylnonan-5-yl)-2-ethylpyrrole (PubChem CID 57120345) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is 2-(2,8-dimethylnonan-5-yl)-2-ethylpyrrole.
| Compound Name | 2-(2,8-dimethylnonan-5-yl)-2-ethylpyrrole |
|---|---|
| PubChem CID | 57120345 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | 2-(2,8-dimethylnonan-5-yl)-2-ethylpyrrole |
| SMILES | CCC1(C(CCC(C)C)CCC(C)C)C=CC=N1 |
| InChI | InChI=1S/C17H31N/c1-6-17(12-7-13-18-17)16(10-8-14(2)3)11-9-15(4)5/h7,12-16H,6,8-11H2,1-5H3 |
| InChIKey | QDZQFNVQESAJQM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |