C20H37N — CID 57138741
2-propyl-2-(2,2,8,8-tetramethylnonan-5-yl)pyrrole (PubChem CID 57138741) has the molecular formula C20H37N and a molecular weight of 291.52 g/mol. Its IUPAC name is 2-propyl-2-(2,2,8,8-tetramethylnonan-5-yl)pyrrole.
| Compound Name | 2-propyl-2-(2,2,8,8-tetramethylnonan-5-yl)pyrrole |
|---|---|
| PubChem CID | 57138741 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | 2-propyl-2-(2,2,8,8-tetramethylnonan-5-yl)pyrrole |
| SMILES | CCCC1(C(CCC(C)(C)C)CCC(C)(C)C)C=CC=N1 |
| InChI | InChI=1S/C20H37N/c1-8-12-20(13-9-16-21-20)17(10-14-18(2,3)4)11-15-19(5,6)7/h9,13,16-17H,8,10-12,14-15H2,1-7H3 |
| InChIKey | JDRDREXOMPVHRW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |