C18H33N — CID 57206629
2-(2,8-dimethylnonan-5-yl)-2-propylpyrrole (PubChem CID 57206629) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is 2-(2,8-dimethylnonan-5-yl)-2-propylpyrrole.
| Compound Name | 2-(2,8-dimethylnonan-5-yl)-2-propylpyrrole |
|---|---|
| PubChem CID | 57206629 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | 2-(2,8-dimethylnonan-5-yl)-2-propylpyrrole |
| SMILES | CCCC1(C(CCC(C)C)CCC(C)C)C=CC=N1 |
| InChI | InChI=1S/C18H33N/c1-6-12-18(13-7-14-19-18)17(10-8-15(2)3)11-9-16(4)5/h7,13-17H,6,8-12H2,1-5H3 |
| InChIKey | WMUOBMXGQUIKAU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |