C20H37N — CID 57136239
2-(2,8-dimethylnonan-5-yl)-2-pentylpyrrole (PubChem CID 57136239) has the molecular formula C20H37N and a molecular weight of 291.52 g/mol. Its IUPAC name is 2-(2,8-dimethylnonan-5-yl)-2-pentylpyrrole.
| Compound Name | 2-(2,8-dimethylnonan-5-yl)-2-pentylpyrrole |
|---|---|
| PubChem CID | 57136239 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | 2-(2,8-dimethylnonan-5-yl)-2-pentylpyrrole |
| SMILES | CCCCCC1(C(CCC(C)C)CCC(C)C)C=CC=N1 |
| InChI | InChI=1S/C20H37N/c1-6-7-8-14-20(15-9-16-21-20)19(12-10-17(2)3)13-11-18(4)5/h9,15-19H,6-8,10-14H2,1-5H3 |
| InChIKey | UGPYTTRVBAVREJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|