C19H35N — CID 57147046
2-propyl-2-(2,2,8-trimethylnonan-5-yl)pyrrole (PubChem CID 57147046) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is 2-propyl-2-(2,2,8-trimethylnonan-5-yl)pyrrole.
| Compound Name | 2-propyl-2-(2,2,8-trimethylnonan-5-yl)pyrrole |
|---|---|
| PubChem CID | 57147046 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | 2-propyl-2-(2,2,8-trimethylnonan-5-yl)pyrrole |
| SMILES | CCCC1(C(CCC(C)C)CCC(C)(C)C)C=CC=N1 |
| InChI | InChI=1S/C19H35N/c1-7-12-19(13-8-15-20-19)17(10-9-16(2)3)11-14-18(4,5)6/h8,13,15-17H,7,9-12,14H2,1-6H3 |
| InChIKey | QRJGOGMBRWPTLU-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |