C15H25N — CID 91209535
N-[2-[1-(2-prop-1-enylcyclopropyl)propan-2-yl]pent-1-enyl]methanimine (PubChem CID 91209535) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-[2-[1-(2-prop-1-enylcyclopropyl)propan-2-yl]pent-1-enyl]methanimine.
| Compound Name | N-[2-[1-(2-prop-1-enylcyclopropyl)propan-2-yl]pent-1-enyl]methanimine |
|---|---|
| PubChem CID | 91209535 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-[2-[1-(2-prop-1-enylcyclopropyl)propan-2-yl]pent-1-enyl]methanimine |
| SMILES | C=NC=C(CCC)C(C)CC1CC1C=CC |
| InChI | InChI=1S/C15H25N/c1-5-7-13-10-15(13)9-12(3)14(8-6-2)11-16-4/h5,7,11-13,15H,4,6,8-10H2,1-3H3 |
| InChIKey | DFVIDDNRALEIGT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|