C14H25N — CID 123838975
N-[2-(2-methylpropyl)-3-propylhexa-1,3-dienyl]methanimine (PubChem CID 123838975) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is N-[2-(2-methylpropyl)-3-propylhexa-1,3-dienyl]methanimine.
| Compound Name | N-[2-(2-methylpropyl)-3-propylhexa-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 123838975 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N-[2-(2-methylpropyl)-3-propylhexa-1,3-dienyl]methanimine |
| SMILES | C=NC=C(CC(C)C)C(=CCC)CCC |
| InChI | InChI=1S/C14H25N/c1-6-8-13(9-7-2)14(11-15-5)10-12(3)4/h8,11-12H,5-7,9-10H2,1-4H3 |
| InChIKey | GPYDZXLPLDDMIT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|