C13H17N — CID 142421851
N-[(1E,3Z)-2-(6-methyl-3-bicyclo[3.1.0]hex-2-enyl)penta-1,3-dienyl]methanimine (PubChem CID 142421851) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is N-[(1E,3Z)-2-(6-methyl-3-bicyclo[3.1.0]hex-2-enyl)penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3Z)-2-(6-methyl-3-bicyclo[3.1.0]hex-2-enyl)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 142421851 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N-[(1E,3Z)-2-(6-methyl-3-bicyclo[3.1.0]hex-2-enyl)penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C/C)C1=CC2C(C)C2C1 |
| InChI | InChI=1S/C13H17N/c1-4-5-10(8-14-3)11-6-12-9(2)13(12)7-11/h4-6,8-9,12-13H,3,7H2,1-2H3/b5-4-,10-8+ |
| InChIKey | WGCGPRPLEPWHLG-BTCMVDHLSA-N |
| XLogP | 3.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|