C18H29N — CID 91451462
N-[4-[2-(4-prop-1-en-2-ylcyclohexyl)ethenyl]cyclohexyl]methanimine (PubChem CID 91451462) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is N-[4-[2-(4-prop-1-en-2-ylcyclohexyl)ethenyl]cyclohexyl]methanimine.
| Compound Name | N-[4-[2-(4-prop-1-en-2-ylcyclohexyl)ethenyl]cyclohexyl]methanimine |
|---|---|
| PubChem CID | 91451462 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | N-[4-[2-(4-prop-1-en-2-ylcyclohexyl)ethenyl]cyclohexyl]methanimine |
| SMILES | C=NC1CCC(C=CC2CCC(C(=C)C)CC2)CC1 |
| InChI | InChI=1S/C18H29N/c1-14(2)17-10-6-15(7-11-17)4-5-16-8-12-18(19-3)13-9-16/h4-5,15-18H,1,3,6-13H2,2H3 |
| InChIKey | SNJDRVQLLFBTTQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|