C24H45NV — CID 160692518
methane;N-[4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methanimine;vanadium (PubChem CID 160692518) has the molecular formula C24H45NV and a molecular weight of 398.58 g/mol. Its IUPAC name is methane;N-[4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methanimine;vanadium.
| Compound Name | methane;N-[4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methanimine;vanadium |
|---|---|
| PubChem CID | 160692518 |
| Molecular Formula | C24H45NV |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | methane;N-[4-[(E)-2-[4-(4-methylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methanimine;vanadium |
| SMILES | C.C.C=NC1CCC(/C=C/C2CCC(C3CCC(C)CC3)CC2)CC1.[V] |
| InChI | InChI=1S/C22H37N.2CH4.V/c1-17-3-11-20(12-4-17)21-13-7-18(8-14-21)5-6-19-9-15-22(23-2)16-10-19;;;/h5-6,17-22H,2-4,7-16H2,1H3;2*1H4;/b6-5+;;; |
| InChIKey | RPOYBNMFKQWJON-FWMLTEASSA-N |
| XLogP | 7.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|