C27H49N — CID 142282765
N,N-dimethyl-4-[(E)-2-[4-(4-pentylcyclohexyl)cyclohexyl]ethenyl]cyclohexan-1-amine (PubChem CID 142282765) has the molecular formula C27H49N and a molecular weight of 387.70 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[4-(4-pentylcyclohexyl)cyclohexyl]ethenyl]cyclohexan-1-amine.
| Compound Name | N,N-dimethyl-4-[(E)-2-[4-(4-pentylcyclohexyl)cyclohexyl]ethenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 142282765 |
| Molecular Formula | C27H49N |
| Molecular Weight | 387.70 g/mol |
| Exact Mass | 387.39 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[4-(4-pentylcyclohexyl)cyclohexyl]ethenyl]cyclohexan-1-amine |
| SMILES | CCCCCC1CCC(C2CCC(/C=C/C3CCC(N(C)C)CC3)CC2)CC1 |
| InChI | InChI=1S/C27H49N/c1-4-5-6-7-22-10-16-25(17-11-22)26-18-12-23(13-19-26)8-9-24-14-20-27(21-15-24)28(2)3/h8-9,22-27H,4-7,10-21H2,1-3H3/b9-8+ |
| InChIKey | VRNOESGQMQDKDZ-CMDGGOBGSA-N |
| XLogP | 7.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.70 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|