C17H33N — CID 123889684
N-(8,10,11-trimethyldodec-3-en-6-yl)ethanimine (PubChem CID 123889684) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is N-(8,10,11-trimethyldodec-3-en-6-yl)ethanimine.
| Compound Name | N-(8,10,11-trimethyldodec-3-en-6-yl)ethanimine |
|---|---|
| PubChem CID | 123889684 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | N-(8,10,11-trimethyldodec-3-en-6-yl)ethanimine |
| SMILES | C/C=N/C(CC=CCC)CC(C)CC(C)C(C)C |
| InChI | InChI=1S/C17H33N/c1-7-9-10-11-17(18-8-2)13-15(5)12-16(6)14(3)4/h8-10,14-17H,7,11-13H2,1-6H3/b10-9?,18-8+ |
| InChIKey | UMSKPBMIXGXCLI-WPZXZKHQSA-N |
| XLogP | 5.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|