C22H27F2NO3 — CID 123840907
N-benzyl-N-(1,1-difluoro-3-hydroxypropan-2-yl)-2-methyl-4-phenylmethoxybutanamide (PubChem CID 123840907) has the molecular formula C22H27F2NO3 and a molecular weight of 391.46 g/mol. Its IUPAC name is N-benzyl-N-(1,1-difluoro-3-hydroxypropan-2-yl)-2-methyl-4-phenylmethoxybutanamide.
| Compound Name | N-benzyl-N-(1,1-difluoro-3-hydroxypropan-2-yl)-2-methyl-4-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 123840907 |
| Molecular Formula | C22H27F2NO3 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | N-benzyl-N-(1,1-difluoro-3-hydroxypropan-2-yl)-2-methyl-4-phenylmethoxybutanamide |
| SMILES | CC(CCOCc1ccccc1)C(=O)N(Cc1ccccc1)C(CO)C(F)F |
| InChI | InChI=1S/C22H27F2NO3/c1-17(12-13-28-16-19-10-6-3-7-11-19)22(27)25(20(15-26)21(23)24)14-18-8-4-2-5-9-18/h2-11,17,20-21,26H,12-16H2,1H3 |
| InChIKey | PSTLSDCBDXWCIZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|