About 2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole
2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole (PubChem CID 123843998) has the molecular formula C9H15NO2
and a molecular weight of 169.22 g/mol. Its IUPAC name is 2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole.
Molecular Properties
| Compound Name | 2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole |
| PubChem CID | 123843998 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole |
| SMILES | COC(OC)C(C)c1ccc[nH]1 |
| InChI | InChI=1S/C9H15NO2/c1-7(9(11-2)12-3)8-5-4-6-10-8/h4-7,9-10H,1-3H3 |
| InChIKey | WCRWLKOPPSDBRK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole?
The IUPAC name of 2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole (CID 123843998) is 2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole.
What is the SMILES notation for 2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole?
The canonical SMILES for 2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole is COC(OC)C(C)c1ccc[nH]1.
What is the InChIKey of 2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole?
The InChIKey is WCRWLKOPPSDBRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2/c1-7(9(11-2)12-3)8-5-4-6-10-8/h4-7,9-10H,1-3H3.
What are the key properties of 2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole?
2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole has a molecular weight of 169.22 g/mol, XLogP of 1.74, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dimethoxypropan-2-yl)-1H-pyrrole is sourced from PubChem (CID 123843998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).