C30H36N2O6 — CID 123844375
[2,5-dimethyl-5-[3-(2-methylaziridine-1-carbonyl)benzoyl]oxyhexan-2-yl] 3-(2-methylaziridine-1-carbonyl)benzoate (PubChem CID 123844375) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is [2,5-dimethyl-5-[3-(2-methylaziridine-1-carbonyl)benzoyl]oxyhexan-2-yl] 3-(2-methylaziridine-1-carbonyl)benzoate.
| Compound Name | [2,5-dimethyl-5-[3-(2-methylaziridine-1-carbonyl)benzoyl]oxyhexan-2-yl] 3-(2-methylaziridine-1-carbonyl)benzoate |
|---|---|
| PubChem CID | 123844375 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | [2,5-dimethyl-5-[3-(2-methylaziridine-1-carbonyl)benzoyl]oxyhexan-2-yl] 3-(2-methylaziridine-1-carbonyl)benzoate |
| SMILES | CC1CN1C(=O)c1cccc(C(=O)OC(C)(C)CCC(C)(C)OC(=O)c2cccc(C(=O)N3CC3C)c2)c1 |
| InChI | InChI=1S/C30H36N2O6/c1-19-17-31(19)25(33)21-9-7-11-23(15-21)27(35)37-29(3,4)13-14-30(5,6)38-28(36)24-12-8-10-22(16-24)26(34)32-18-20(32)2/h7-12,15-16,19-20H,13-14,17-18H2,1-6H3 |
| InChIKey | NIGMCFJLUUJTIW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|