C9H16N2O — CID 123844544
(4-buta-1,3-dien-2-ylpiperazin-2-yl)methanol (PubChem CID 123844544) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is (4-buta-1,3-dien-2-ylpiperazin-2-yl)methanol.
| Compound Name | (4-buta-1,3-dien-2-ylpiperazin-2-yl)methanol |
|---|---|
| PubChem CID | 123844544 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (4-buta-1,3-dien-2-ylpiperazin-2-yl)methanol |
| SMILES | C=CC(=C)N1CCNC(CO)C1 |
| InChI | InChI=1S/C9H16N2O/c1-3-8(2)11-5-4-10-9(6-11)7-12/h3,9-10,12H,1-2,4-7H2 |
| InChIKey | LDHRPXLQCOGZBA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|