C18H18F2N6 — CID 123844945
N'-[5-[(3,4-difluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl]methanediamine (PubChem CID 123844945) has the molecular formula C18H18F2N6 and a molecular weight of 356.38 g/mol. Its IUPAC name is N'-[5-[(3,4-difluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl]methanediamine.
| Compound Name | N'-[5-[(3,4-difluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl]methanediamine |
|---|---|
| PubChem CID | 123844945 |
| Molecular Formula | C18H18F2N6 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N'-[5-[(3,4-difluorophenyl)methyl]-4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-yl]methanediamine |
| SMILES | Cc1cc2c(cc(NCN)c3nnc(C)n32)n1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H18F2N6/c1-10-5-17-16(25(10)8-12-3-4-13(19)14(20)6-12)7-15(22-9-21)18-24-23-11(2)26(17)18/h3-7,22H,8-9,21H2,1-2H3 |
| InChIKey | BEMIVGZMZLZQOG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|