C28H44O2 — CID 123845107
10-hydroxy-2,4a,6a,9,9,12a-hexamethyl-2,3,4,5,6,6a,6b,7,8,8a,10,11,12,14b-tetradecahydro-1H-picen-13-one (PubChem CID 123845107) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is 10-hydroxy-2,4a,6a,9,9,12a-hexamethyl-2,3,4,5,6,6a,6b,7,8,8a,10,11,12,14b-tetradecahydro-1H-picen-13-one.
| Compound Name | 10-hydroxy-2,4a,6a,9,9,12a-hexamethyl-2,3,4,5,6,6a,6b,7,8,8a,10,11,12,14b-tetradecahydro-1H-picen-13-one |
|---|---|
| PubChem CID | 123845107 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 10-hydroxy-2,4a,6a,9,9,12a-hexamethyl-2,3,4,5,6,6a,6b,7,8,8a,10,11,12,14b-tetradecahydro-1H-picen-13-one |
| SMILES | CC1CCC2(C)CCC3(C)C(=CC(=O)C4C3CCC3C(C)(C)C(O)CCC43C)C2C1 |
| InChI | InChI=1S/C28H44O2/c1-17-9-11-26(4)13-14-27(5)18-7-8-22-25(2,3)23(30)10-12-28(22,6)24(18)21(29)16-20(27)19(26)15-17/h16-19,22-24,30H,7-15H2,1-6H3 |
| InChIKey | GOJSSFPDRWXYCF-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |