C29H46O3 — CID 3649554
10-hydroxy-2,4a,6a,9,9,12a-hexamethyl-3,4,5,6,6a,6b,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-2-carboxylic acid (PubChem CID 3649554) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is 10-hydroxy-2,4a,6a,9,9,12a-hexamethyl-3,4,5,6,6a,6b,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-2-carboxylic acid.
| Compound Name | 10-hydroxy-2,4a,6a,9,9,12a-hexamethyl-3,4,5,6,6a,6b,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-2-carboxylic acid |
|---|---|
| PubChem CID | 3649554 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | 10-hydroxy-2,4a,6a,9,9,12a-hexamethyl-3,4,5,6,6a,6b,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCC2(C)CCC3(C)C(=CCC4C3CCC3C(C)(C)C(O)CCC43C)C2C1 |
| InChI | InChI=1S/C29H46O3/c1-25(2)22-10-9-18-19(29(22,6)12-11-23(25)30)7-8-20-21-17-27(4,24(31)32)14-13-26(21,3)15-16-28(18,20)5/h8,18-19,21-23,30H,7,9-17H2,1-6H3,(H,31,32) |
| InChIKey | OHUGBIGEVDVYSF-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|