C24H30N4O — CID 123846087
2-(1H-indol-3-ylmethyl)-9-(3-methyl-2,5-dihydropyridin-2-yl)-2,9-diazaspiro[5.5]undecan-1-one (PubChem CID 123846087) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-(1H-indol-3-ylmethyl)-9-(3-methyl-2,5-dihydropyridin-2-yl)-2,9-diazaspiro[5.5]undecan-1-one.
| Compound Name | 2-(1H-indol-3-ylmethyl)-9-(3-methyl-2,5-dihydropyridin-2-yl)-2,9-diazaspiro[5.5]undecan-1-one |
|---|---|
| PubChem CID | 123846087 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 2-(1H-indol-3-ylmethyl)-9-(3-methyl-2,5-dihydropyridin-2-yl)-2,9-diazaspiro[5.5]undecan-1-one |
| SMILES | CC1=CCC=NC1N1CCC2(CCCN(Cc3c[nH]c4ccccc34)C2=O)CC1 |
| InChI | InChI=1S/C24H30N4O/c1-18-6-4-12-25-22(18)27-14-10-24(11-15-27)9-5-13-28(23(24)29)17-19-16-26-21-8-3-2-7-20(19)21/h2-3,6-8,12,16,22,26H,4-5,9-11,13-15,17H2,1H3 |
| InChIKey | PAVMHPSDFBUFIJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|