C25H25N5O — CID 67984473
2-(1H-indol-3-ylmethyl)-9-quinoxalin-2-yl-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 67984473) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-(1H-indol-3-ylmethyl)-9-quinoxalin-2-yl-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | 2-(1H-indol-3-ylmethyl)-9-quinoxalin-2-yl-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 67984473 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 2-(1H-indol-3-ylmethyl)-9-quinoxalin-2-yl-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | O=C1N(Cc2c[nH]c3ccccc23)CCC12CCCN(c1cnc3ccccc3n1)C2 |
| InChI | InChI=1S/C25H25N5O/c31-24-25(11-13-29(24)16-18-14-26-20-7-2-1-6-19(18)20)10-5-12-30(17-25)23-15-27-21-8-3-4-9-22(21)28-23/h1-4,6-9,14-15,26H,5,10-13,16-17H2 |
| InChIKey | RXWDGOSLEFIURT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |