C17H20N4O — CID 97142246
(5S)-7-methyl-2-quinoxalin-2-yl-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 97142246) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is (5S)-7-methyl-2-quinoxalin-2-yl-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | (5S)-7-methyl-2-quinoxalin-2-yl-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 97142246 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (5S)-7-methyl-2-quinoxalin-2-yl-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | CN1CCC[C@@]2(CCN(c3cnc4ccccc4n3)C2)C1=O |
| InChI | InChI=1S/C17H20N4O/c1-20-9-4-7-17(16(20)22)8-10-21(12-17)15-11-18-13-5-2-3-6-14(13)19-15/h2-3,5-6,11H,4,7-10,12H2,1H3/t17-/m0/s1 |
| InChIKey | KKVCHIUSGSERBO-KRWDZBQOSA-N |
| XLogP | 2.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |