C28H33FN3O2+ — CID 123847722
1-[4-[3-(4-fluorophenyl)-7-methyl-1-propan-2-yl-7,8-dihydropyrrolo[1,2-a]azepin-4-ium-6-carbonyl]-2-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 123847722) has the molecular formula C28H33FN3O2+ and a molecular weight of 462.59 g/mol. Its IUPAC name is 1-[4-[3-(4-fluorophenyl)-7-methyl-1-propan-2-yl-7,8-dihydropyrrolo[1,2-a]azepin-4-ium-6-carbonyl]-2-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[3-(4-fluorophenyl)-7-methyl-1-propan-2-yl-7,8-dihydropyrrolo[1,2-a]azepin-4-ium-6-carbonyl]-2-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 123847722 |
| Molecular Formula | C28H33FN3O2+ |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 1-[4-[3-(4-fluorophenyl)-7-methyl-1-propan-2-yl-7,8-dihydropyrrolo[1,2-a]azepin-4-ium-6-carbonyl]-2-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C(=O)C2=C[N+]3=C(c4ccc(F)cc4)C=C(C(C)C)C3=CCC2C)CC1C |
| InChI | InChI=1S/C28H33FN3O2/c1-6-27(33)31-14-13-30(16-20(31)5)28(34)24-17-32-25(12-7-19(24)4)23(18(2)3)15-26(32)21-8-10-22(29)11-9-21/h6,8-12,15,17-20H,1,7,13-14,16H2,2-5H3/q+1 |
| InChIKey | JHFPVBNUXYUCIY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 43.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|