C26H29FN3O3+ — CID 123306438
7-[3-(4-fluorophenyl)-7-methyl-1-propan-2-yl-7,8-dihydropyrrolo[1,2-a]azepin-4-ium-6-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one (PubChem CID 123306438) has the molecular formula C26H29FN3O3+ and a molecular weight of 450.53 g/mol. Its IUPAC name is 7-[3-(4-fluorophenyl)-7-methyl-1-propan-2-yl-7,8-dihydropyrrolo[1,2-a]azepin-4-ium-6-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one.
| Compound Name | 7-[3-(4-fluorophenyl)-7-methyl-1-propan-2-yl-7,8-dihydropyrrolo[1,2-a]azepin-4-ium-6-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one |
|---|---|
| PubChem CID | 123306438 |
| Molecular Formula | C26H29FN3O3+ |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 7-[3-(4-fluorophenyl)-7-methyl-1-propan-2-yl-7,8-dihydropyrrolo[1,2-a]azepin-4-ium-6-carbonyl]-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,2-a]pyrazin-3-one |
| SMILES | CC(C)C1=CC(c2ccc(F)cc2)=[N+]2C=C(C(=O)N3CCN4C(=O)COC4C3)C(C)CC=C12 |
| InChI | InChI=1S/C26H29FN3O3/c1-16(2)20-12-23(18-5-7-19(27)8-6-18)30-13-21(17(3)4-9-22(20)30)26(32)28-10-11-29-24(31)15-33-25(29)14-28/h5-9,12-13,16-17,25H,4,10-11,14-15H2,1-3H3/q+1 |
| InChIKey | MYXMJKFYJOSGAU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|