C22H27F3N2O3 — CID 123847765
2,2-difluoro-N-[2-[3-fluoro-1-[4-[6-(1-hydroxyethyl)-3-pyridinyl]phenyl]-2-methylpropoxy]propan-2-yl]acetamide (PubChem CID 123847765) has the molecular formula C22H27F3N2O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2,2-difluoro-N-[2-[3-fluoro-1-[4-[6-(1-hydroxyethyl)-3-pyridinyl]phenyl]-2-methylpropoxy]propan-2-yl]acetamide.
| Compound Name | 2,2-difluoro-N-[2-[3-fluoro-1-[4-[6-(1-hydroxyethyl)-3-pyridinyl]phenyl]-2-methylpropoxy]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 123847765 |
| Molecular Formula | C22H27F3N2O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2,2-difluoro-N-[2-[3-fluoro-1-[4-[6-(1-hydroxyethyl)-3-pyridinyl]phenyl]-2-methylpropoxy]propan-2-yl]acetamide |
| SMILES | CC(O)c1ccc(-c2ccc(C(OC(C)(C)NC(=O)C(F)F)C(C)CF)cc2)cn1 |
| InChI | InChI=1S/C22H27F3N2O3/c1-13(11-23)19(30-22(3,4)27-21(29)20(24)25)16-7-5-15(6-8-16)17-9-10-18(14(2)28)26-12-17/h5-10,12-14,19-20,28H,11H2,1-4H3,(H,27,29) |
| InChIKey | UGXKYPMDWKZKPC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|