C14H29N3O2 — CID 123848410
tert-butyl N-[1-(ethylamino)-1-methyliminopentan-2-yl]-N-methylcarbamate (PubChem CID 123848410) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is tert-butyl N-[1-(ethylamino)-1-methyliminopentan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-(ethylamino)-1-methyliminopentan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123848410 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | tert-butyl N-[1-(ethylamino)-1-methyliminopentan-2-yl]-N-methylcarbamate |
| SMILES | CCCC(/C(=N/C)NCC)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H29N3O2/c1-8-10-11(12(15-6)16-9-2)17(7)13(18)19-14(3,4)5/h11H,8-10H2,1-7H3,(H,15,16) |
| InChIKey | VOSGWVGJKPGQAL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|