C33H38N4O4 — CID 123848763
(17S,18S)-12-ethenyl-7-ethyl-18-(2-formyloxyethyl)-3,8,13,17,20-pentamethyl-17,18,21,22,23,24-hexahydroporphyrin-2-carboxylic acid (PubChem CID 123848763) has the molecular formula C33H38N4O4 and a molecular weight of 554.69 g/mol. Its IUPAC name is (17S,18S)-12-ethenyl-7-ethyl-18-(2-formyloxyethyl)-3,8,13,17,20-pentamethyl-17,18,21,22,23,24-hexahydroporphyrin-2-carboxylic acid.
| Compound Name | (17S,18S)-12-ethenyl-7-ethyl-18-(2-formyloxyethyl)-3,8,13,17,20-pentamethyl-17,18,21,22,23,24-hexahydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 123848763 |
| Molecular Formula | C33H38N4O4 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | (17S,18S)-12-ethenyl-7-ethyl-18-(2-formyloxyethyl)-3,8,13,17,20-pentamethyl-17,18,21,22,23,24-hexahydroporphyrin-2-carboxylic acid |
| SMILES | C=Cc1c2[nH]c(c1C)C=C1NC(=C(C)c3[nH]c(c(C)c3C(=O)O)C=c3[nH]c(c(C)c3CC)=C2)[C@@H](CCOC=O)[C@@H]1C |
| InChI | InChI=1S/C33H38N4O4/c1-8-21-16(3)24-12-26-18(5)23(10-11-41-15-38)31(36-26)20(7)32-30(33(39)40)19(6)27(37-32)14-29-22(9-2)17(4)25(35-29)13-28(21)34-24/h8,12-15,18,23,34-37H,1,9-11H2,2-7H3,(H,39,40)/t18-,23-/m0/s1 |
| InChIKey | QYKUMZNIGWIOLM-MBSDFSHPSA-N |
| XLogP | 4.66 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|